Introduction:Basic information about CAS 59094-49-4|1,4-Naphthoquinone, 2-(butylthio)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,4-Naphthoquinone, 2-(butylthio)- |
|---|
| CAS Number | 59094-49-4 | Molecular Weight | 246.32500 |
|---|
| Density | 1.21g/cm3 | Boiling Point | 384.9ºC at 760 mmHg |
|---|
| Molecular Formula | C14H14O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 165.8ºC |
|---|
Names
| Name | 2-butylsulfanylnaphthalene-1,4-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.21g/cm3 |
|---|
| Boiling Point | 384.9ºC at 760 mmHg |
|---|
| Molecular Formula | C14H14O2S |
|---|
| Molecular Weight | 246.32500 |
|---|
| Flash Point | 165.8ºC |
|---|
| Exact Mass | 246.07100 |
|---|
| PSA | 59.44000 |
|---|
| LogP | 3.48280 |
|---|
| Index of Refraction | 1.6 |
|---|
| InChIKey | LCKZKKVDONIRPE-UHFFFAOYSA-N |
|---|
| SMILES | CCCCSC1=CC(=O)c2ccccc2C1=O |
|---|
Synonyms
| 2-(1-thiobutyl)-1,4-naphthoquinone |
| 2-butylsulfanyl-[1,4]naphthoquinone |
| 1,2-(butylthio) |
| 1,4-Naphthoquinone,2-(butylthio) |
| 2-butylthio-1,4-naphthoquinone |
| 2-(butylthio)naphthalene-1,4-dione |
| 2-Butylmercapto-[1,4]naphthochinon |