Introduction:Basic information about CAS 80-20-6|2-Aminophenol-4-sulfonanilide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Aminophenol-4-sulfonanilide |
|---|
| CAS Number | 80-20-6 | Molecular Weight | 264.30000 |
|---|
| Density | 1.474 g/cm3 | Boiling Point | 485.6ºC at 760 mmHg |
|---|
| Molecular Formula | C12H12N2O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 247.5ºC |
|---|
Names
| Name | 3-amino-4-hydroxy-N-phenylbenzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.474 g/cm3 |
|---|
| Boiling Point | 485.6ºC at 760 mmHg |
|---|
| Molecular Formula | C12H12N2O3S |
|---|
| Molecular Weight | 264.30000 |
|---|
| Flash Point | 247.5ºC |
|---|
| Exact Mass | 264.05700 |
|---|
| PSA | 100.80000 |
|---|
| LogP | 3.51020 |
|---|
| Index of Refraction | 1.667 |
|---|
| InChIKey | IAOZVUUQCPRLOI-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cc(S(=O)(=O)Nc2ccccc2)ccc1O |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| 3-Amino-4-hydroxybenzenesulfonanilide |
| 2-amino-4-benzenesulfonamidophenol |
| EINECS 201-258-9 |
| 2-Aminophenol-4-sulfonanilide |
| Metanilanilide,4-hydroxy |
| 3-amino-4-hydroxy-benzenesulfonic acid anilide |
| 3-Amino-4-hydroxy-benzolsulfonsaeure-anilid |
| Benzenesulfonamide,3-amino-4-hydroxy-N-phenyl |
| 4-Hydroxymetanilanilide |
| 2-amino-1-hydroxybenzene-4-sulphonic acid-N-phenylamide |