Introduction：Basic information about CAS 21733-00-6|Methyl 3-nitro-1H-1,2,4-triazole-5-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 3-nitro-1H-1,2,4-triazole-5-carboxylate |
|---|
| CAS Number | 21733-00-6 | Molecular Weight | 172.09900 |
|---|
| Density | 1.655g/cm3 | Boiling Point | 428.3ºC at 760 mmHg |
|---|
| Molecular Formula | C4H4N4O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 212.8ºC |
|---|
Names
| Name | methyl 3-nitro-1H-1,2,4-triazole-5-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.655g/cm3 |
|---|
| Boiling Point | 428.3ºC at 760 mmHg |
|---|
| Molecular Formula | C4H4N4O4 |
|---|
| Molecular Weight | 172.09900 |
|---|
| Flash Point | 212.8ºC |
|---|
| Exact Mass | 172.02300 |
|---|
| PSA | 113.69000 |
|---|
| LogP | 0.02270 |
|---|
| Vapour Pressure | 1.53E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.592 |
|---|
| InChIKey | YYOJQHLOAOGWKJ-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1n[nH]c([N+](=O)[O-])n1 |
|---|
Synonyms
| 5-nitro-2H-[1,2,4]triazole-3-carboxylic acid methyl ester |
| 3-nitro-1,2,4-triazole 5-carboxylic acid methyl ester |
| 3-Nitro-5-carbomethoxy-1.2.4-triazol |
