Introduction:Basic information about CAS 38185-06-7|Benzenesulfonic acid, 4-chloro-3,5-dinitro-, potassium salt, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenesulfonic acid, 4-chloro-3,5-dinitro-, potassium salt |
|---|
| CAS Number | 38185-06-7 | Molecular Weight | 321.71400 |
|---|
| Density | 1.911g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C6H3ClKN2O7S+ | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | potassium,4-chloro-3,5-dinitrobenzenesulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.911g/cm3 |
|---|
| Molecular Formula | C6H3ClKN2O7S+ |
|---|
| Molecular Weight | 321.71400 |
|---|
| Exact Mass | 320.89900 |
|---|
| PSA | 154.39000 |
|---|
| LogP | 3.53030 |
|---|
| InChIKey | SOKIKHRZBYSIFN-UHFFFAOYSA-M |
|---|
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)[O-])cc([N+](=O)[O-])c1Cl.[K+] |
|---|
Safety Information
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| potassium 3,5-dinitro-4-chlorosulfonate |
| 4-chloro-3,5-dinitro-benzenesulfonic acid,potassium-compound |
| 3,5-dinitro-4-chlorobenzenesulfonate |
| EINECS 253-816-6 |
| potassium 4-chloro-3,5-dinitrobenzene sulfonate |
| Benzenesulfonic acid,4-chloro-3,5-dinitro-,potassium salt |
| AmbscCN4/4099 |
| 4-Chloro-3,5-dinitrobenzenesulfonic acid potassium salt |
| 4-Chlor-3,5-dinitro-benzolsulfonsaeure,Kalium-Verbindung |
| Potassium 4-chloro-3,5-dinitrobenzenesulphonate |