Introduction：Basic information about CAS 20071-53-8|eupatundin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | eupatundin |
|---|
| CAS Number | 20071-53-8 | Molecular Weight | 376.40000 |
|---|
| Density | 1.35g/cm3 | Boiling Point | 580.3ºC at 760 mmHg |
|---|
| Molecular Formula | C20H24O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 206.4ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.35g/cm3 |
|---|
| Boiling Point | 580.3ºC at 760 mmHg |
|---|
| Molecular Formula | C20H24O7 |
|---|
| Molecular Weight | 376.40000 |
|---|
| Flash Point | 206.4ºC |
|---|
| Exact Mass | 376.15200 |
|---|
| PSA | 105.59000 |
|---|
| LogP | 0.80140 |
|---|
| Vapour Pressure | 6.95E-16mmHg at 25°C |
|---|
| Index of Refraction | 1.591 |
|---|
| InChIKey | NFHWFFQENCGSQZ-VAGPNBDPSA-N |
|---|
| SMILES | C=C1C(=O)OC2C1C(OC(=O)C(C)=CC)CC(=C)C1C(O)C3OC3(C)C21O |
|---|
