Introduction：Basic information about CAS 54023-04-0|5-(2-methoxyphenyl)furan-2-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(2-methoxyphenyl)furan-2-carboxylic acid |
|---|
| CAS Number | 54023-04-0 | Molecular Weight | 218.20500 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C12H10O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 5-(2-methoxyphenyl)furan-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C12H10O4 |
|---|
| Molecular Weight | 218.20500 |
|---|
| Exact Mass | 218.05800 |
|---|
| PSA | 59.67000 |
|---|
| LogP | 2.65340 |
|---|
| InChIKey | CHWVDGYLKPLBES-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccccc1-c1ccc(C(=O)O)o1 |
|---|
Safety Information
Customs
| HS Code | 2932190090 |
|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| 5-(2-Methoxyphenyl)-2-furancarbonsaeure |
| 5-(o-Methoxyphenyl)-2-carboxy-furan |
| B21 |
| 5-(2-Methoxyphenyl)-furane-2-carboxylic acid |
| 5-(2-methoxyphenyl)-2-furoic acid |
| 5-(2-methoxy-phenyl)-furan-2-carboxylic acid |
