Introduction:Basic information about CAS 2103-92-6|4-(4-METHYLPHENYL)-1,3-THIAZOLE-2-THIOL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(4-METHYLPHENYL)-1,3-THIAZOLE-2-THIOL |
|---|
| CAS Number | 2103-92-6 | Molecular Weight | 207.31500 |
|---|
| Density | 1.32g/cm3 | Boiling Point | 347ºC at 760mmHg |
|---|
| Molecular Formula | C10H9NS2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 163.7ºC |
|---|
Names
| Name | 4-(4-methylphenyl)-3H-1,3-thiazole-2-thione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.32g/cm3 |
|---|
| Boiling Point | 347ºC at 760mmHg |
|---|
| Molecular Formula | C10H9NS2 |
|---|
| Molecular Weight | 207.31500 |
|---|
| Flash Point | 163.7ºC |
|---|
| Exact Mass | 207.01800 |
|---|
| PSA | 79.93000 |
|---|
| LogP | 3.40720 |
|---|
| Vapour Pressure | 5.53E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.715 |
|---|
| InChIKey | IFHSFJUUGCCKOC-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(-c2csc(=S)[nH]2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| 2-Mercapto-4-(p-methylphenyl)thiazole |
| 4-p-tolyl-3H-thiazole-2-thione |
| HMS2672H04 |
| 4-(4-methylphenyl)-1,3-thiazole-2-thiol |
| 2-Mercapto-4-p-tolyl-thiazol |
| 4-(4-methylphenyl)-2-mercaptothiazole |
| 2-mercapto-4-(4-methylphenyl)thiazole |