Introduction:Basic information about CAS 142121-48-0|N-t-BOC-D-Leucinol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-t-BOC-D-Leucinol |
|---|
| CAS Number | 142121-48-0 | Molecular Weight | 217.305 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 319.3±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H23NO3 | Melting Point | / |
|---|
| MSDS | Chinese | Flash Point | 146.9±23.2 °C |
|---|
Names
| Name | tert-butyl N-(1-hydroxy-4-methylpentan-2-yl)carbamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 319.3±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H23NO3 |
|---|
| Molecular Weight | 217.305 |
|---|
| Flash Point | 146.9±23.2 °C |
|---|
| Exact Mass | 217.167801 |
|---|
| PSA | 58.56000 |
|---|
| LogP | 2.25 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.454 |
|---|
| InChIKey | LQTMEOSBXTVYRM-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)CC(CO)NC(=O)OC(C)(C)C |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;half-mask respirator (US);multi-purpose combination respirator cartridge (US) |
|---|
| Hazard Codes | Xi |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2924199090 |
|---|
Customs
| HS Code | 2924199090 |
|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Boc-D-leucinol |
| Boc-DL-Leucinol |
| (R)-tert-Butyl (1-hydroxy-4-methylpentan-2-yl)carbamate |
| N-t-BOC-D-Leucinol |
| (R)-N-(tert-Butoxycarbonyl)leucinol |
| Carbamic acid, N-[(1R)-1-(hydroxymethyl)-3-methylbutyl]-, 1,1-dimethylethyl ester |
| Boc-D-Leu-ol |
| Boc-(R)-2-amino-4-methyl-1-pentanol |
| N-Boc-DL-Leucinol |
| 2(R)-t-butoxycarbonylamino-4-methylpentanol |
| Boc-Leu-ol |
| 2-Methyl-2-propanyl [(2R)-1-hydroxy-4-methyl-2-pentanyl]carbamate |
| N-BOC-D-Leucinol |
| ((R)-1-hydroxymethyl-3-methyl-butyl)-carbamic acid tert-butyl ester |
| tert-Butyl [(2R)-1-hydroxy-4-methylpentan-2-yl]carbamate |