Introduction:Basic information about CAS 1196154-77-4|4,4-Difluorocyclohexanesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4-Difluorocyclohexanesulfonyl chloride |
|---|
| CAS Number | 1196154-77-4 | Molecular Weight | 218.649 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 259.8±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H9ClF2O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 110.9±27.3 °C |
|---|
Names
| Name | 4,4-Difluorocyclohexane-1-sulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 259.8±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H9ClF2O2S |
|---|
| Molecular Weight | 218.649 |
|---|
| Flash Point | 110.9±27.3 °C |
|---|
| Exact Mass | 217.997986 |
|---|
| PSA | 42.52000 |
|---|
| LogP | 1.38 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.459 |
|---|
| InChIKey | NABYUBSREFQSDU-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Cl)C1CCC(F)(F)CC1 |
|---|
Synonyms
| Cyclohexanesulfonyl chloride, 4,4-difluoro- |
| 4,4-difluoro-cyclohexanesulfonyl chloride |
| 4,4-Difluorocyclohexanesulfonyl chloride |