Introduction：Basic information about CAS 128564-57-8|BUTTPARK 99\18-37, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | BUTTPARK 99\18-37 |
|---|
| CAS Number | 128564-57-8 | Molecular Weight | 247.00200 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C6H3Cl2F3N2O | Melting Point | 100ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 5-chloro-1-methyl-3-(trifluoromethyl)pyrazole-4-carbonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 100ºC |
|---|
| Molecular Formula | C6H3Cl2F3N2O |
|---|
| Molecular Weight | 247.00200 |
|---|
| Exact Mass | 245.95700 |
|---|
| PSA | 34.89000 |
|---|
| LogP | 2.47130 |
|---|
| InChIKey | YGIMKPAWLFTFLV-UHFFFAOYSA-N |
|---|
| SMILES | Cn1nc(C(F)(F)F)c(C(=O)Cl)c1Cl |
|---|
Safety Information
| Hazard Codes | C:Corrosive |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
| HS Code | 2933199090 |
|---|
Customs
| HS Code | 2933199090 |
|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 5-chloro-1-methyl-3-trifluoromethylpyrazole-4-carboxylic acid chloride |
| 5-chloro-1-methyl-3-trifluoromethylpyrazole-4-carboxylic chloride |
| 5-chloro-1-methyl-3-trifluoromethylpyrazole-4-carbonyl chloride |
| 5-chloro-1-methyl-3-trifluoromethylpyrazol-4-carboxylic acid chloride |
| 5-chloro-3-trifluoromethyl-1-methylpyrazole-4-carbonyl chloride |
