Introduction：Basic information about CAS 123334-16-7|tetrahydroxy-1,4-quinone hydrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tetrahydroxy-1,4-quinone hydrate |
|---|
| CAS Number | 123334-16-7 | Molecular Weight | 172.09200 |
|---|
| Density | 2.609g/cm3 | Boiling Point | 370.6ºC at 760mmHg |
|---|
| Molecular Formula | C6H4O6 | Melting Point | >300ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 192.1ºC |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | Tetrahydroxy-1,4-benzoquinone Hydrate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.609g/cm3 |
|---|
| Boiling Point | 370.6ºC at 760mmHg |
|---|
| Melting Point | >300ºC(lit.) |
|---|
| Molecular Formula | C6H4O6 |
|---|
| Molecular Weight | 172.09200 |
|---|
| Flash Point | 192.1ºC |
|---|
| Exact Mass | 172.00100 |
|---|
| PSA | 115.06000 |
|---|
| Vapour Pressure | 5.3E-07mmHg at 25°C |
|---|
| InChIKey | CJFTUKFVMMYYHH-UHFFFAOYSA-N |
|---|
| SMILES | O.O=C1C(O)=C(O)C(=O)C(O)=C1O |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 2,3,5,6-Tetrahydroxycyclohexa-2,5-diene-1,4-dione hydrate |
| Tetrahydroxyquinone Hydrate |
| Tetroquinone Hydrate |
| Tetrahydroxy-1,4-benzoquinone |
| MFCD00149070 |
| EINECS 206-275-5 |
