Introduction:Basic information about CAS 125248-71-7|1,4-Di[4-(6-acryloyloxyhexyloxy)benzoyloxy]-2-methylbenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,4-Di[4-(6-acryloyloxyhexyloxy)benzoyloxy]-2-methylbenzene |
|---|
| CAS Number | 125248-71-7 | Molecular Weight | 656.76100 |
|---|
| Density | 1.156g/cm3 | Boiling Point | 779.2ºC at 760 mmHg |
|---|
| Molecular Formula | C39H44O9 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 314.5ºC |
|---|
Names
| Name | 2-Methyl-1,4-phenylene bis(4-((6-(acryloyloxy)hexyl)oxy)benzoate) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.156g/cm3 |
|---|
| Boiling Point | 779.2ºC at 760 mmHg |
|---|
| Molecular Formula | C39H44O9 |
|---|
| Molecular Weight | 656.76100 |
|---|
| Flash Point | 314.5ºC |
|---|
| Exact Mass | 656.29900 |
|---|
| PSA | 114.43000 |
|---|
| LogP | 7.93390 |
|---|
| Vapour Pressure | 3.19E-24mmHg at 25°C |
|---|
| Index of Refraction | 1.548 |
|---|
| InChIKey | FQCKIWWAEIOPSD-UHFFFAOYSA-N |
|---|
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCCCCOC(=O)C=C)cc3)c(C)c2)cc1 |
|---|
| Storage condition | 2-8℃ |
|---|
Synonyms
| [3-methyl-4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| R6M |
| RM82 |
| C6M RM82 |
| 1,4-Di[4-(6-acryloyloxyhexyloxy)benzoyloxy]-2-methylbenzene |