Introduction：Basic information about CAS 73573-87-2|N-[2-Hydroxy-5-[1-hydroxy-2-[1-(4-methoxyphenyl)propan-2-ylamino]ethyl]phenyl]formami, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[2-Hydroxy-5-[1-hydroxy-2-[1-(4-methoxyphenyl)propan-2-ylamino]ethyl]phenyl]formamide |
|---|
| CAS Number | 73573-87-2 | Molecular Weight | 344.405 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 603.2±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H24N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 318.6±31.5 °C |
|---|
Names
| Name | N-[2-hydroxy-5-(1-hydroxy-2-{[1-(4-methoxyphenyl)propan-2-yl]amino}ethyl)phenyl]formamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 603.2±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H24N2O4 |
|---|
| Molecular Weight | 344.405 |
|---|
| Flash Point | 318.6±31.5 °C |
|---|
| Exact Mass | 344.173615 |
|---|
| PSA | 90.82000 |
|---|
| LogP | 1.57 |
|---|
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.617 |
|---|
| InChIKey | BPZSYCZIITTYBL-ORAYPTAESA-N |
|---|
| SMILES | COc1ccc(CC(C)NCC(O)c2ccc(O)c(NC=O)c2)cc1 |
|---|
| Storage condition | -20°C |
|---|
| Stability | Stable. Incompatible with strong oxidizing agents. |
|---|
| Water Solubility | DMSO: 20 mg/mL, soluble |
|---|
Safety Information
| WGK Germany | 3 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 3-Acetoxycycloheptene |
| E-3-octen-2-ol |
| rac-(N-[2-hydroxy-5-[(1RS)-1-hydroxy-2-[[(1RS)-2-(4-methoxyphenyl)-1-methylethyl]-amino]ethyl]phenyl]formamide) |
| (E)-2-hydroxy-3-octene |
| N-[2-hydroxy-5-[(1RS)-1-hydroxy-2-[[(1RS)-2-(4-methoxyphenyl)-1-methylethyl]amino]ethyl]phenyl]-formamide |
| N-[2-Hydroxy-5-[1-hydroxy-2-[1-(4-methoxyphenyl)propan-2-ylamino]ethyl]phenyl]formamide |
| N-[2-Hydroxy-5-(1-hydroxy-2-{[1-(4-methoxyphenyl)propan-2-yl]amino}ethyl)phenyl]formamide |
| rac-(E)-3-acetoxycycloheptene |
| Formamide, N-[2-hydroxy-5-[1-hydroxy-2-[[2-(4-methoxyphenyl)-1-methylethyl]amino]ethyl]phenyl]- |
| rac-cyclohept-2-en-1-yl acetate |
| cyclohept-2-enyl acetate |
| (+/-)-2-hydroxy-5-[(1RS)-1-hydroxy-2-[[(1RS)-2-(4-methoxyphenyl)-1-methylethyl]amino]ethyl]formanilide |
| 2-Cyclohepten-1-ol,acetate (6CI,7CI,8CI,9CI) |
| 2-Cyclohepten-1-ol,1-acetate |
| (E)-oct-3-en-2-ol |
| 2-Cycloheptenylacetate |
| (A'A A'A currency)-3-Acetoxycycloheptene |
| 2-Cyclohepten-1-yl acetate |
| MFCD05662345 |
| trans-3-octen-2-ol |
| N-[2-Hydroxy-5-(1-hydroxy-2-{[1-(4-methoxyphenyl)-2-propanyl]amino}ethyl)phenyl]formamide |
| rac-(E)-3-octen-2-ol |
| N-[2-hydroxy-5-[1-hydroxy-2-[1-(4-methoxyphenyl)propan-2-ylamino]ethyl]-phenyl]methanamide |
| rac-3-acetoxycycloheptene |
