Introduction：Basic information about CAS 73738-06-4|Primidone-d5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Primidone-d5 |
|---|
| CAS Number | 73738-06-4 | Molecular Weight | 223.28300 |
|---|
| Density | 1.165g/cm3 | Boiling Point | 520.702ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9D5N2O2 | Melting Point | 278-280ºC |
|---|
| MSDS | / | Flash Point | 228.225ºC |
|---|
Names
| Name | 5-(1,1,2,2,2-pentadeuterioethyl)-5-phenyl-1,3-diazinane-4,6-dione |
|---|
| Synonym | More Synonyms |
|---|
Primidone-d5 BiologicalActivity
Chemical & Physical Properties
| Density | 1.165g/cm3 |
|---|
| Boiling Point | 520.702ºC at 760 mmHg |
|---|
| Melting Point | 278-280ºC |
|---|
| Molecular Formula | C12H9D5N2O2 |
|---|
| Molecular Weight | 223.28300 |
|---|
| Flash Point | 228.225ºC |
|---|
| Exact Mass | 223.13700 |
|---|
| PSA | 58.20000 |
|---|
| LogP | 1.19550 |
|---|
| Index of Refraction | 1.529 |
|---|
| InChIKey | DQMZLTXERSFNPB-ZBJDZAJPSA-N |
|---|
| SMILES | CCC1(c2ccccc2)C(=O)NCNC1=O |
|---|
| Storage condition | -20°C |
|---|
Synonyms
| Primidon-ethyl-d(5) |
| Primidone-d5 |
| Liskantin-d5 |
| Mysoline-d5 |
| [2H5]-Primidone |
| Mylepsinum-d5 |
| Sertan-d5 |
| Resimatil-d5 |
