Introduction：Basic information about CAS 75957-60-7|Splenopentin acetate salt, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Splenopentin acetate salt |
|---|
| CAS Number | 75957-60-7 | Molecular Weight | 187.201 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 428.8±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H9N5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 213.1±26.5 °C |
|---|
Names
| Name | sp-5 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 428.8±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H9N5 |
|---|
| Molecular Weight | 187.201 |
|---|
| Flash Point | 213.1±26.5 °C |
|---|
| Exact Mass | 187.085800 |
|---|
| PSA | 90.18000 |
|---|
| LogP | -0.80 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.745 |
|---|
| InChIKey | DRCNRVYVCHHIJP-AQBORDMYSA-N |
|---|
| SMILES | CC(C)C(NC(=O)C(CCC(=O)O)NC(=O)C(CCCCN)NC(=O)C(N)CCCN=C(N)N)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
|---|
Synonyms
| Arginyltryptophane |
| H-ARG-LYS-GLU-VAL-TYR-OH |
| 2-(4-Quinazolinyl)guanidine |
| Arg-Trp |
| Arg-Lys-Glu-Val-Tyr |
| L-Tryptophan,L-arginyl |
| L-arginyl-L-tryptophan |
| Guanidine, N''-4-quinazolinyl- |
| L-Arg-L-Trp |
| Arginyl-Tryptophan |
