Introduction:Basic information about CAS 38454-21-6|4-n-butyloxyphenyl 4-n-hexylbenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-n-butyloxyphenyl 4-n-hexylbenzoate |
|---|
| CAS Number | 38454-21-6 | Molecular Weight | 354.48300 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C23H30O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-n-butyloxyphenyl 4-n-hexylbenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C23H30O3 |
|---|
| Molecular Weight | 354.48300 |
|---|
| Exact Mass | 354.21900 |
|---|
| PSA | 35.53000 |
|---|
| LogP | 6.20750 |
|---|
| InChIKey | DFHWCSVHLVOKND-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCc1ccc(C(=O)Oc2ccc(OCCCC)cc2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| p-butoxyphenyl-p-hexylbenzoate |
| 4-n-butylhydroxyphenyl-4'-n-hexylhydroxybenzoate |
| 4-n-Hexylbenzoesaeure-4-n-butyloxyphenylester |
| 4-n-butylcyclopent-2-enone |
| 4-n-Hexylbenzoesaeure-<4'-butyloxyphenylester> |
| 4-n-butoxy pheny hexyl benzoate |
| 2-Cyclopenten-1-one,4-butyl |
| 4-butyl-2-cyclopentenone |