Introduction:Basic information about CAS 1204-28-0|Trimellitic Anhydride Chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Trimellitic Anhydride Chloride |
|---|
| CAS Number | 1204-28-0 | Molecular Weight | 210.571 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 391.4±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H3ClO4 | Melting Point | 66-68 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 186.3±22.2 °C |
|---|
| Symbol | GHS05 | Signal Word | Danger |
|---|
Names
| Name | Trimellitic Anhydride Chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 391.4±25.0 °C at 760 mmHg |
|---|
| Melting Point | 66-68 °C(lit.) |
|---|
| Molecular Formula | C9H3ClO4 |
|---|
| Molecular Weight | 210.571 |
|---|
| Flash Point | 186.3±22.2 °C |
|---|
| Exact Mass | 209.971985 |
|---|
| PSA | 60.44000 |
|---|
| LogP | 1.59 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.631 |
|---|
| InChIKey | NJMOHBDCGXJLNJ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)c1ccc2c(c1)C(=O)OC2=O |
|---|
| Storage condition | 2-8°C |
|---|
| Water Solubility | decomposes |
|---|
Safety Information
| Symbol | GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Precautionary Statements | P280-P303 + P361 + P353-P304 + P340 + P310-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
|---|
| Hazard Codes | C:Corrosive; |
|---|
| Risk Phrases | R29;R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
| RIDADR | UN 3261 8/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2932999099 |
|---|
Customs
| HS Code | 2932999099 |
|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| Trimellitic Anhydride Chloride |
| 4-(Chlorocarbonyl)phthalic anhydride |
| Phthalic anhydride, 4- (chloroformyl)- |
| 1,3-Dioxo-1,3-dihydro-isobenzofuran-5-carbonyl chloride |
| MFCD00005924 |
| Benzene-1,2,4-tricarboxylic 1,2-anhydride 4-chloride |
| ANHYDROTRIMELLITIC ACID CHLORIDE |
| Phthalic anhydride, 4-(chloroformyl)- |
| 4-Chloroformylphthalic Anhydride |
| Trimellitic anhydride acid chloride |
| 4-(chloroformyl)phthalic anhydride |
| 1,3-dioxo-2-benzofuran-5-carbonyl chloride |
| Trimellitic acid anhydride chloride |
| 1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carbonyl chloride |
| 5-Isobenzofurancarbonyl chloride, 1,3-dihydro-1,3-dioxo- |
| EINECS 214-874-8 |