Introduction：Basic information about CAS 112789-90-9|Osthenone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Osthenone |
|---|
| CAS Number | 112789-90-9 | Molecular Weight | 244.243 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 475.1±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H12O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 215.2±28.8 °C |
|---|
Names
| Name | 7-Methoxy-8-[(1E)-3-oxo-1-buten-1-yl]-2H-chromen-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 475.1±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H12O4 |
|---|
| Molecular Weight | 244.243 |
|---|
| Flash Point | 215.2±28.8 °C |
|---|
| Exact Mass | 244.073563 |
|---|
| PSA | 56.51000 |
|---|
| LogP | 1.82 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.601 |
|---|
| InChIKey | FNFVAKUIMOKUQL-ZZXKWVIFSA-N |
|---|
| SMILES | COc1ccc2ccc(=O)oc2c1C=CC(C)=O |
|---|
Safety Information
Synonyms
| 7t-Octadecensaeure |
| (E)-osthenone |
| 7-methoxy-8-[(1E)-3-oxobut-1-enyl]-2H-chromen-2-one |
| 7-Octadecenoic acid,(7Z) |
| 7-Methoxy-8-[(1E)-3-oxo-1-buten-1-yl]-2H-chromen-2-one |
| octadec-7t-enoic acid |
| Octadec-7t-ensaeure |
| 2H-1-Benzopyran-2-one, 7-methoxy-8-[(1E)-3-oxo-1-buten-1-yl]- |
| 7-Octadecenoic acid,(7E) |
| 7-Octadecenoic acid |
| (E)-octadec-7-enoic acid |
| C18:1 (7-E) |
| Octadec-7-ensaeure |
