Introduction:Basic information about CAS 20628-19-7|N-(3-Methoxy-4-nitrophenyl)acetamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(3-Methoxy-4-nitrophenyl)acetamide |
|---|
| CAS Number | 20628-19-7 | Molecular Weight | 210.187 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 444.4±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H10N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 222.6±25.9 °C |
|---|
Names
| Name | N-(3-Methoxy-4-nitrophenyl)acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 444.4±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H10N2O4 |
|---|
| Molecular Weight | 210.187 |
|---|
| Flash Point | 222.6±25.9 °C |
|---|
| Exact Mass | 210.064056 |
|---|
| PSA | 87.64000 |
|---|
| LogP | 1.70 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.594 |
|---|
| InChIKey | ROIFYZDOQOPGNG-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(NC(C)=O)ccc1[N+](=O)[O-] |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 6-Nitro-3-acetamino-phenol-methylaether |
| N-(3-Methoxy-4-nitrophenyl)acetamide |
| acetic acid-(3-methoxy-4-nitro-anilide) |
| 6-Nitro-3-acetamino-anisol |
| Acetamide, N-(3-methoxy-4-nitrophenyl)- |
| Essigsaeure-(3-methoxy-4-nitro-anilid) |
| QC-2376 |
| RW3112 |
| 3-methoxy-4-nitroacetanilide |