Introduction：Basic information about CAS 158010-68-5|(2S)-2-[[5-[3-(2,6-diamino-4-oxo-1H-pyrimidin-5-yl)propylamino]thiophene-2-carbonyl], including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2S)-2-[[5-[3-(2,6-diamino-4-oxo-1H-pyrimidin-5-yl)propylamino]thiophene-2-carbonyl]amino]pentanedioic acid |
|---|
| CAS Number | 158010-68-5 | Molecular Weight | 438.45800 |
|---|
| Density | 1.68g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C17H22N6O6S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (2S)-2-[[5-[3-(2,6-diamino-4-oxo-1H-pyrimidin-5-yl)propylamino]thiophene-2-carbonyl]amino]pentanedioic acid |
|---|
Chemical & Physical Properties
| Density | 1.68g/cm3 |
|---|
| Molecular Formula | C17H22N6O6S |
|---|
| Molecular Weight | 438.45800 |
|---|
| Exact Mass | 438.13200 |
|---|
| PSA | 242.75000 |
|---|
| LogP | 1.47580 |
|---|
| Index of Refraction | 1.74 |
|---|
| InChIKey | XZEOVCAIZUBENT-VIFPVBQESA-N |
|---|
| SMILES | Nc1nc(N)c(CCCNc2ccc(C(=O)NC(CCC(=O)O)C(=O)O)s2)c(=O)[nH]1 |
|---|
