Introduction：Basic information about CAS 20544-37-0|3,9-dibenzyl-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane 3,9-dioxide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,9-dibenzyl-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane 3,9-dioxide |
|---|
| CAS Number | 20544-37-0 | Molecular Weight | 408.32200 |
|---|
| Density | 1.34g/cm3 | Boiling Point | 576.5ºC at 760mmHg |
|---|
| Molecular Formula | C19H22O6P2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 315.3ºC |
|---|
Names
| Name | 3,9-Dibenzyl-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane 3, 9-dioxide |
|---|
Chemical & Physical Properties
| Density | 1.34g/cm3 |
|---|
| Boiling Point | 576.5ºC at 760mmHg |
|---|
| Molecular Formula | C19H22O6P2 |
|---|
| Molecular Weight | 408.32200 |
|---|
| Flash Point | 315.3ºC |
|---|
| Exact Mass | 408.08900 |
|---|
| PSA | 90.68000 |
|---|
| LogP | 4.85300 |
|---|
| Vapour Pressure | 1.08E-12mmHg at 25°C |
|---|
| Index of Refraction | 1.575 |
|---|
| InChIKey | XRBKIMPIQSGVAO-UHFFFAOYSA-N |
|---|
| SMILES | O=P1(Cc2ccccc2)OCC2(CO1)COP(=O)(Cc1ccccc1)OC2 |
|---|
