Introduction:Basic information about CAS 116233-17-1|5,6,7,8-tetrahydro-3,5,5,8,8-pentamethyl-2-naphthalenamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,6,7,8-tetrahydro-3,5,5,8,8-pentamethyl-2-naphthalenamine |
|---|
| CAS Number | 116233-17-1 | Molecular Weight | 217.35000 |
|---|
| Density | 0.938 g/cm3 | Boiling Point | 321.2ºC at 760 mmHg |
|---|
| Molecular Formula | C15H23N | Melting Point | / |
|---|
| MSDS | / | Flash Point | 148.8ºC |
|---|
Names
| Name | 3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.938 g/cm3 |
|---|
| Boiling Point | 321.2ºC at 760 mmHg |
|---|
| Molecular Formula | C15H23N |
|---|
| Molecular Weight | 217.35000 |
|---|
| Flash Point | 148.8ºC |
|---|
| Exact Mass | 217.18300 |
|---|
| PSA | 26.02000 |
|---|
| LogP | 4.50740 |
|---|
| InChIKey | NDQSUCPZRPRYLX-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc2c(cc1N)C(C)(C)CCC2(C)C |
|---|
Safety Information
Customs
| HS Code | 2921450090 |
|---|
| Summary | 2921450090 1-naphthylamine (α-naphthylamine), 2-naphthylamine (β-naphthylamine) and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 1,2,3,4-tetrahydro-1,1,4,4,6-pentamethyl-7-aminonaphthalene |
| 3-amino-5,6,7,8-tetrahydro-2,5,5,8,8-pentamethylnaphthalene |
| 3-methyl-5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-naphthylamine |
| 5,6,7,8-tetrahydro-3,5,5,8,8-pentamethylnaphtalen-2-amine |
| 3,5,5,8,8-pentamethyl-5,6,7,8-tetrahydronaphthalen-2-amine |
| 6-Amino-1,2,3,4-tetrahydro-1,1,4,4,7-pentamethylnaphthalene |
| 2-amino-3,5,5,8,8-pentamethyl-5,6,7,8-tetrahydronaphthalene |
| 2-Naphthalenamine,5,6,7,8-tetrahydro-3,5,5,8,8-pentamethyl |
| 3,5,5,8,8-pentamethyl-5,6,7,8-tetrahydronaphthalen-2-ylamine |