Introduction:Basic information about CAS 263015-85-6|2-[4-(4,5-dihydro-1,3-thiazol-2-yl)phenoxy]-N'-hydroxyethanimidamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[4-(4,5-dihydro-1,3-thiazol-2-yl)phenoxy]-N'-hydroxyethanimidamide |
|---|
| CAS Number | 263015-85-6 | Molecular Weight | 251.30500 |
|---|
| Density | 1.41g/cm3 | Boiling Point | 505.8ºC at 760 mmHg |
|---|
| Molecular Formula | C11H13N3O2S | Melting Point | 200-203ºC |
|---|
| MSDS | / | Flash Point | 259.7ºC |
|---|
Names
| Name | 2-[4-(4,5-dihydro-1,3-thiazol-2-yl)phenoxy]-N'-hydroxyethanimidamide |
|---|
Chemical & Physical Properties
| Density | 1.41g/cm3 |
|---|
| Boiling Point | 505.8ºC at 760 mmHg |
|---|
| Melting Point | 200-203ºC |
|---|
| Molecular Formula | C11H13N3O2S |
|---|
| Molecular Weight | 251.30500 |
|---|
| Flash Point | 259.7ºC |
|---|
| Exact Mass | 251.07300 |
|---|
| PSA | 103.00000 |
|---|
| LogP | 1.44110 |
|---|
| Vapour Pressure | 4.7E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.67 |
|---|
| InChIKey | XTOPDTAGTUIJTD-UHFFFAOYSA-N |
|---|
| SMILES | NC(COc1ccc(C2=NCCS2)cc1)=NO |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|