Introduction：Basic information about CAS 263400-90-4|2-Chloro-N-(3-nitrophenyl)-4-pyridinecarboxamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-N-(3-nitrophenyl)-4-pyridinecarboxamide |
|---|
| CAS Number | 263400-90-4 | Molecular Weight | 277.66300 |
|---|
| Density | 1.498g/cm3 | Boiling Point | 371.995ºC at 760 mmHg |
|---|
| Molecular Formula | C12H8ClN3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 178.776ºC |
|---|
Names
| Name | 2-chloro-N-(3-nitrophenyl)pyridine-4-carboxamide |
|---|
Chemical & Physical Properties
| Density | 1.498g/cm3 |
|---|
| Boiling Point | 371.995ºC at 760 mmHg |
|---|
| Molecular Formula | C12H8ClN3O3 |
|---|
| Molecular Weight | 277.66300 |
|---|
| Flash Point | 178.776ºC |
|---|
| Exact Mass | 277.02500 |
|---|
| PSA | 91.30000 |
|---|
| LogP | 3.80270 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.684 |
|---|
| InChIKey | RVVKEFXKLPBYAD-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)c1ccnc(Cl)c1 |
|---|
