Introduction：Basic information about CAS 302961-71-3|3-amino-N-(2,4,6-trimethylphenyl)pyridine-4-carboxamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-amino-N-(2,4,6-trimethylphenyl)pyridine-4-carboxamide |
|---|
| CAS Number | 302961-71-3 | Molecular Weight | 255.31500 |
|---|
| Density | 1.2g/cm3 | Boiling Point | 375ºC at 760 mmHg |
|---|
| Molecular Formula | C15H17N3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 180.6ºC |
|---|
Names
| Name | 3-amino-N-(2,4,6-trimethylphenyl)pyridine-4-carboxamide |
|---|
Chemical & Physical Properties
| Density | 1.2g/cm3 |
|---|
| Boiling Point | 375ºC at 760 mmHg |
|---|
| Molecular Formula | C15H17N3O |
|---|
| Molecular Weight | 255.31500 |
|---|
| Flash Point | 180.6ºC |
|---|
| Exact Mass | 255.13700 |
|---|
| PSA | 68.01000 |
|---|
| LogP | 3.49550 |
|---|
| Index of Refraction | 1.65 |
|---|
| InChIKey | ZBWWOESLYGPBRC-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C)c(NC(=O)c2ccncc2N)c(C)c1 |
|---|
