Introduction:Basic information about CAS 300355-34-4|3-Cyclopentyl-2-(3,4-dichlorophenyl)propanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Cyclopentyl-2-(3,4-dichlorophenyl)propanoic acid |
|---|
| CAS Number | 300355-34-4 | Molecular Weight | 287.18200 |
|---|
| Density | 1.289g/cm3 | Boiling Point | 409.6ºC at 760 mmHg |
|---|
| Molecular Formula | C14H16Cl2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 201.5ºC |
|---|
Names
| Name | 3-Cyclopentyl-2-(3,4-dichlorophenyl)propanoic acid |
|---|
Chemical & Physical Properties
| Density | 1.289g/cm3 |
|---|
| Boiling Point | 409.6ºC at 760 mmHg |
|---|
| Molecular Formula | C14H16Cl2O2 |
|---|
| Molecular Weight | 287.18200 |
|---|
| Flash Point | 201.5ºC |
|---|
| Exact Mass | 286.05300 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 4.74190 |
|---|
| Index of Refraction | 1.567 |
|---|
| InChIKey | FJSODZKQLZQDHD-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C(CC1CCCC1)c1ccc(Cl)c(Cl)c1 |
|---|