Introduction:Basic information about CAS 433728-73-5|2-(4-amino-3-pyridyl)-N,N-diisopropyl-benzamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-amino-3-pyridyl)-N,N-diisopropyl-benzamide |
|---|
| CAS Number | 433728-73-5 | Molecular Weight | 297.39500 |
|---|
| Density | 1.092g/cm3 | Boiling Point | 505.502ºC at 760 mmHg |
|---|
| Molecular Formula | C18H23N3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 259.518ºC |
|---|
Names
| Name | 2-(4-amino-3-pyridyl)-N,N-diisopropyl-benzamide |
|---|
Chemical & Physical Properties
| Density | 1.092g/cm3 |
|---|
| Boiling Point | 505.502ºC at 760 mmHg |
|---|
| Molecular Formula | C18H23N3O |
|---|
| Molecular Weight | 297.39500 |
|---|
| Flash Point | 259.518ºC |
|---|
| Exact Mass | 297.18400 |
|---|
| PSA | 59.95000 |
|---|
| LogP | 3.51990 |
|---|
| Index of Refraction | 1.575 |
|---|
| InChIKey | KRDXCIKACUMFSP-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)N(C(=O)c1ccccc1-c1cnccc1N)C(C)C |
|---|