Introduction：Basic information about CAS 70161-09-0|Democonazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Democonazole |
|---|
| CAS Number | 70161-09-0 | Molecular Weight | 409.69400 |
|---|
| Density | 1.32g/cm3 | Boiling Point | 569.8ºC at 760 mmHg |
|---|
| Molecular Formula | C19H15Cl3N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 298.4ºC |
|---|
Names
| Name | 1-[(E)-2-[2-(4-chlorophenoxy)ethoxy]-2-(2,4-dichlorophenyl)ethenyl]imidazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.32g/cm3 |
|---|
| Boiling Point | 569.8ºC at 760 mmHg |
|---|
| Molecular Formula | C19H15Cl3N2O2 |
|---|
| Molecular Weight | 409.69400 |
|---|
| Flash Point | 298.4ºC |
|---|
| Exact Mass | 408.02000 |
|---|
| PSA | 36.28000 |
|---|
| LogP | 5.89450 |
|---|
| Index of Refraction | 1.601 |
|---|
| InChIKey | ABVFVJRTKMVJMV-XDHOZWIPSA-N |
|---|
| SMILES | Clc1ccc(OCCOC(=Cn2ccnc2)c2ccc(Cl)cc2Cl)cc1 |
|---|
Synonyms
| Democonazolum |
| Democonazole |
| Democonazol |
| UNII-2Z4E7E087J |
| Democonazol [INN-Spanish] |
| Democonazolum [INN-Latin] |
