Introduction:Basic information about CAS 20170-20-1|Difenamizole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Difenamizole |
|---|
| CAS Number | 20170-20-1 | Molecular Weight | 334.41500 |
|---|
| Density | 1.13g/cm3 | Boiling Point | 543.6ºC at 760mmHg |
|---|
| Molecular Formula | C20H22N4O | Melting Point | 123-128°; mp 120-122° |
|---|
| MSDS | / | Flash Point | 282.6ºC |
|---|
Names
| Name | N-(1,3-Diphenyl-1H-pyrazol-5-yl)-N2,N2-dimethylalaninamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.13g/cm3 |
|---|
| Boiling Point | 543.6ºC at 760mmHg |
|---|
| Melting Point | 123-128°; mp 120-122° |
|---|
| Molecular Formula | C20H22N4O |
|---|
| Molecular Weight | 334.41500 |
|---|
| Flash Point | 282.6ºC |
|---|
| Exact Mass | 334.17900 |
|---|
| PSA | 50.16000 |
|---|
| LogP | 3.50090 |
|---|
| Vapour Pressure | 7.07E-12mmHg at 25°C |
|---|
| Index of Refraction | 1.604 |
|---|
| InChIKey | PCXMKBOWWVXEDT-UHFFFAOYSA-N |
|---|
| SMILES | CC(C(=O)Nc1cc(-c2ccccc2)nn1-c1ccccc1)N(C)C |
|---|
Safety Information
Customs
| HS Code | 2933199090 |
|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| Diphenacin |
| Promar |
| (2-diphenylacetyl)indan-1,3-dione |
| 2-diphenylacetyl-1,3-indandione |
| Difenamizole |
| diphenadione |
| Diphenadion |
| Oragulant |
| difenadione |
| Didandin |
| 2-(diphenylacetyl)indandione-1,3 |
| Diphacinone |
| N,N-dimethyl-alanine 2,5-diphenyl-2H-pyrazol-3-ylamide |
| 2-(diphenylacetyl)indanedione-1,3 |
| Diphenandione |
| Dipaxin |
| Diphacin |