Introduction：Basic information about CAS 59831-63-9|Doconazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Doconazole |
|---|
| CAS Number | 59831-63-9 | Molecular Weight | 481.37000 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 665.6±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C26H22Cl2N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 356.3±31.5 °C |
|---|
Names
| Name | 1-[[(2S,4R)-2-(2,4-dichlorophenyl)-4-[(4-phenylphenoxy)methyl]-1, 3-dioxolan-2-yl]methyl]imidazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 665.6±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C26H22Cl2N2O3 |
|---|
| Molecular Weight | 481.37000 |
|---|
| Flash Point | 356.3±31.5 °C |
|---|
| Exact Mass | 480.10100 |
|---|
| PSA | 45.51000 |
|---|
| LogP | 6.60 |
|---|
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.629 |
|---|
| InChIKey | GNZHVEIGGFMLSP-OZXSUGGESA-N |
|---|
| SMILES | Clc1ccc(C2(Cn3ccnc3)OCC(COc3ccc(-c4ccccc4)cc3)O2)c(Cl)c1 |
|---|
Synonyms
| 1-[4-biphenyl-4-yloxymethyl-2-(2,4-dichloro-phenyl)-[1,3]dioxolan-2-ylmethyl]-1H-imidazole |
| Doconazole |
| 1-{[(2S,4R)-4-[(4-Biphenylyloxy)methyl]-2-(2,4-dichlorophenyl)-1,3-dioxolan-2-yl]methyl}-1H-imidazole |
| 1-{[(2S,4R)-4-[(Biphenyl-4-yloxy)methyl]-2-(2,4-dichlorophenyl)-1,3-dioxolan-2-yl]methyl}-1H-imidazole |
| 1H-Imidazole, 1-[[(2S,4R)-4-[([1,1'-biphenyl]-4-yloxy)methyl]-2-(2,4-dichlorophenyl)-1,3-dioxolan-2-yl]methyl]- |
| cis-1-((4-(((1,1'-Biphenyl)-4-yloxy)methyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-2-yl)methyl)-1H-imidazole |
| cis-1-((4-((4-Biphenyloxy)methyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-2-yl)methyl)imidazole |
