Introduction：Basic information about CAS 150756-35-7|2-[2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]ethoxy]acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]ethoxy]acetic acid |
|---|
| CAS Number | 150756-35-7 | Molecular Weight | 390.42400 |
|---|
| Density | 1.256g/cm3 | Boiling Point | 517.5ºC at 760mmHg |
|---|
| Molecular Formula | C21H24F2N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 266.7ºC |
|---|
Names
| Name | 2-[2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]ethoxy]acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.256g/cm3 |
|---|
| Boiling Point | 517.5ºC at 760mmHg |
|---|
| Molecular Formula | C21H24F2N2O3 |
|---|
| Molecular Weight | 390.42400 |
|---|
| Flash Point | 266.7ºC |
|---|
| Exact Mass | 390.17500 |
|---|
| PSA | 53.01000 |
|---|
| LogP | 2.64880 |
|---|
| Vapour Pressure | 1.56E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.563 |
|---|
| InChIKey | BAWMMJAUVBLLEE-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)COCCN1CCN(C(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
|---|
Synonyms
| Efletirizine |
| Efletirizine [INN] |
