Introduction:Basic information about CAS 5579-16-8|(R)-2-FLUOROBENZHYDROL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (R)-2-FLUOROBENZHYDROL |
|---|
| CAS Number | 5579-16-8 | Molecular Weight | 209.00700 |
|---|
| Density | 1.32g/cm3 | Boiling Point | 395.5ºC at 760mmHg |
|---|
| Molecular Formula | C9H12BNO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 193ºC |
|---|
Names
| Name | 5-[(1R)-1-Hydroxy-2-(methylamino)ethyl]-1,3,2-benzodioxaborol-2-o l |
|---|
Chemical & Physical Properties
| Density | 1.32g/cm3 |
|---|
| Boiling Point | 395.5ºC at 760mmHg |
|---|
| Molecular Formula | C9H12BNO4 |
|---|
| Molecular Weight | 209.00700 |
|---|
| Flash Point | 193ºC |
|---|
| Exact Mass | 209.08600 |
|---|
| PSA | 70.95000 |
|---|
| LogP | 0.07870 |
|---|
| Index of Refraction | 1.576 |
|---|
| InChIKey | ZNMXKJDERFMXNF-ZETCQYMHSA-N |
|---|
| SMILES | CNCC(O)c1ccc2c(c1)OB(O)O2 |
|---|