Introduction:Basic information about CAS 75963-52-9|Nuclomedone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Nuclomedone |
|---|
| CAS Number | 75963-52-9 | Molecular Weight | 294.75700 |
|---|
| Density | 1.54g/cm3 | Boiling Point | 438.7ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11ClN2O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 219.1ºC |
|---|
Names
| Name | 6-[(4-chlorophenyl)methyl]-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-5,7-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.54g/cm3 |
|---|
| Boiling Point | 438.7ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11ClN2O2S |
|---|
| Molecular Weight | 294.75700 |
|---|
| Flash Point | 219.1ºC |
|---|
| Exact Mass | 294.02300 |
|---|
| PSA | 75.04000 |
|---|
| LogP | 1.34380 |
|---|
| Index of Refraction | 1.729 |
|---|
| InChIKey | QSKVYHYMQQQAFS-UHFFFAOYSA-N |
|---|
| SMILES | O=C1N=C2SCCN2C(=O)C1Cc1ccc(Cl)cc1 |
|---|
Synonyms
| TEI 3096 |
| TI 31 |
| ( inverted exclamation markA)-6-(4-chlorobenzyl)-2,3-dihydro-5h-[1,3]thiazolo[3,2-a]pyrimidine-5,7(6h)-dione |
| Nuclomedone |
| Nuclomedonum [Latin] |
| (+-)-6-(p-Chlorobenzyl)-2,3-dihydro-5H-thiazolo(3,2-a)pyrimidine-5,7(6H)-dione |
| Nuclomedona [Spanish] |
| 6-p-Chlorobenzyl-5H-2,3,6,7-tetrahydro-5,7-dioxothiazolo(3,2-a)pyrimidine |