Introduction：Basic information about CAS 99258-56-7|8,8-dimethoxy-2-phenyl-3,5,6,7-tetrahydro-2H-imidazo[1,2-a]pyridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 8,8-dimethoxy-2-phenyl-3,5,6,7-tetrahydro-2H-imidazo[1,2-a]pyridine |
|---|
| CAS Number | 99258-56-7 | Molecular Weight | 260.33100 |
|---|
| Density | 1.17g/cm3 | Boiling Point | 396.8ºC at 760mmHg |
|---|
| Molecular Formula | C15H20N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 193.8ºC |
|---|
Names
| Name | 8,8-dimethoxy-2-phenyl-3,5,6,7-tetrahydro-2H-imidazo[1,2-a]pyridine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.17g/cm3 |
|---|
| Boiling Point | 396.8ºC at 760mmHg |
|---|
| Molecular Formula | C15H20N2O2 |
|---|
| Molecular Weight | 260.33100 |
|---|
| Flash Point | 193.8ºC |
|---|
| Exact Mass | 260.15200 |
|---|
| PSA | 34.06000 |
|---|
| LogP | 1.59820 |
|---|
| Index of Refraction | 1.585 |
|---|
| InChIKey | DWIKEPVFPTUJQU-UHFFFAOYSA-N |
|---|
| SMILES | COC1(OC)CCCN2CC(c3ccccc3)N=C21 |
|---|
Synonyms
| Oxamisol |
| Oxamisole |
| UNII-MW5753V737 |
| Oxamisolum [INN-Latin] |
| Oxamisolum |
| Oxamisol [INN-Spanish] |
| 8,8-Dimethoxy-2-phenyl-2,3,5,6,7,8-hexahydroimidazo(1,2-a)pyridine |
