Introduction:Basic information about CAS 119811-95-9|2-(4-Methylphenyl)-5-(trifluoromethyl)pyridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-Methylphenyl)-5-(trifluoromethyl)pyridine |
|---|
| CAS Number | 119811-95-9 | Molecular Weight | 237.22000 |
|---|
| Density | / | Boiling Point | 282.167ºC at 760 mmHg |
|---|
| Molecular Formula | C13H10F3N | Melting Point | / |
|---|
| MSDS | / | Flash Point | 124.451ºC |
|---|
Names
| Name | 2-(4-Methylphenyl)-5-(trifluoromethyl)pyridine |
|---|
Chemical & Physical Properties
| Boiling Point | 282.167ºC at 760 mmHg |
|---|
| Molecular Formula | C13H10F3N |
|---|
| Molecular Weight | 237.22000 |
|---|
| Flash Point | 124.451ºC |
|---|
| Exact Mass | 237.07700 |
|---|
| PSA | 12.89000 |
|---|
| LogP | 4.07580 |
|---|
| Vapour Pressure | 0.006mmHg at 25°C |
|---|
| Index of Refraction | 1.506 |
|---|
| InChIKey | KOBLIIVILPJPGR-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(-c2ccc(C(F)(F)F)cn2)cc1 |
|---|