Introduction：Basic information about CAS 4399-52-4|Tri-ortho-thymotide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tri-ortho-thymotide |
|---|
| CAS Number | 4399-52-4 | Molecular Weight | 528.63500 |
|---|
| Density | 1.139g/cm3 | Boiling Point | 658.9ºC at 760 mmHg |
|---|
| Molecular Formula | C33H36O6 | Melting Point | 219-221ºC(lit.) |
|---|
| MSDS | / | Flash Point | 275.2ºC |
|---|
Names
| Name | Tri-ortho-thymotide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.139g/cm3 |
|---|
| Boiling Point | 658.9ºC at 760 mmHg |
|---|
| Melting Point | 219-221ºC(lit.) |
|---|
| Molecular Formula | C33H36O6 |
|---|
| Molecular Weight | 528.63500 |
|---|
| Flash Point | 275.2ºC |
|---|
| Exact Mass | 528.25100 |
|---|
| PSA | 78.90000 |
|---|
| LogP | 7.95300 |
|---|
| Index of Refraction | 1.559 |
|---|
| InChIKey | ZIKHLMVJGCYVAC-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(C(C)C)c2c1C(=O)Oc1c(C(C)C)ccc(C)c1C(=O)Oc1c(C(C)C)ccc(C)c1C(=O)O2 |
|---|
Synonyms
| tri-o-thymotide |
| Cyclic trilactone of o-thymotic acid |
| Tri-O-Ahymotide |
