Introduction：Basic information about CAS 143343-83-3|6-{3-[(3,4-Dimethoxybenzyl)amino]-2-hydroxypropoxy}-2-quinolinol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-{3-[(3,4-Dimethoxybenzyl)amino]-2-hydroxypropoxy}-2-quinolinol |
|---|
| CAS Number | 143343-83-3 | Molecular Weight | 384.42600 |
|---|
| Density | 1.236g/cm3 | Boiling Point | 661.8ºC at 760mmHg |
|---|
| Molecular Formula | C21H24N2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 354ºC |
|---|
Names
| Name | 6-{3-[(3,4-Dimethoxybenzyl)amino]-2-hydroxypropoxy}-2-quinolinol |
|---|
Chemical & Physical Properties
| Density | 1.236g/cm3 |
|---|
| Boiling Point | 661.8ºC at 760mmHg |
|---|
| Molecular Formula | C21H24N2O5 |
|---|
| Molecular Weight | 384.42600 |
|---|
| Flash Point | 354ºC |
|---|
| Exact Mass | 384.16900 |
|---|
| PSA | 92.81000 |
|---|
| LogP | 2.46570 |
|---|
| Vapour Pressure | 2.05E-18mmHg at 25°C |
|---|
| Index of Refraction | 1.59 |
|---|
| InChIKey | BYKYPZBCMBEEGU-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(CNCC(O)COc2ccc3[nH]c(=O)ccc3c2)cc1OC |
|---|
