Introduction：Basic information about CAS 149579-07-7|1-(4-hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)heptane-3,5-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(4-hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)heptane-3,5-dione |
|---|
| CAS Number | 149579-07-7 | Molecular Weight | 342.38600 |
|---|
| Density | 1.22g/cm3 | Boiling Point | 543.821ºC at 760 mmHg |
|---|
| Molecular Formula | C20H22O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 192.417ºC |
|---|
Names
| Name | 1-(4-hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)heptane-3,5-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.22g/cm3 |
|---|
| Boiling Point | 543.821ºC at 760 mmHg |
|---|
| Molecular Formula | C20H22O5 |
|---|
| Molecular Weight | 342.38600 |
|---|
| Flash Point | 192.417ºC |
|---|
| Exact Mass | 342.14700 |
|---|
| PSA | 83.83000 |
|---|
| LogP | 3.20010 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.584 |
|---|
| InChIKey | HJFYFYWETUVIHT-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(CCC(=O)CC(=O)CCc2ccc(O)cc2)ccc1O |
|---|
Synonyms
| 44D8X9U00T |
| 3,5-Heptanedione,1-(4-hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl) |
| Demethoxytetrahydrocurcumin |
| UNII-44D8X9U00T |
| Tetrahydrodemethoxycurcumin |
| Tetrahydrodemethoxydiferuloylmethane |
