Introduction：Basic information about CAS 42212-75-9|diethyl 2-oxoheptane-1,7-dicarboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | diethyl 2-oxoheptane-1,7-dicarboxylate |
|---|
| CAS Number | 42212-75-9 | Molecular Weight | 230.25800 |
|---|
| Density | 1.075g/cm3 | Boiling Point | 302.9ºC at 760 mmHg |
|---|
| Molecular Formula | C11H18O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 129.1ºC |
|---|
Names
| Name | diethyl 2-oxoheptane-1,7-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.075g/cm3 |
|---|
| Boiling Point | 302.9ºC at 760 mmHg |
|---|
| Molecular Formula | C11H18O5 |
|---|
| Molecular Weight | 230.25800 |
|---|
| Flash Point | 129.1ºC |
|---|
| Exact Mass | 230.11500 |
|---|
| PSA | 69.67000 |
|---|
| LogP | 1.24210 |
|---|
| Index of Refraction | 1.441 |
|---|
| InChIKey | HLKMXFSQQZYBEW-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)CCCCC(=O)C(=O)OCC |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| oxo-2 pimelate d'ethyle |
| 2-Oxopentanoic acid ethyl ester |
| ethyl 2-oxopentoate |
| Ethyl 2-oxo-pentanoate |
| Ethyl 2-oxovalerate |
| ethyl oxopentanoate |
| 2-oxo-valeric acid ethyl ester |
| ethyl 2-oxo-pimelate |
| diethyl 2-oxopimelate |
| Pentanoic acid,2-oxo-,ethyl ester |
| 2-Oxo-valeriansaeure-aethylester |
