Introduction:Basic information about CAS 119482-69-8|4-BENZYL-5-THIOXO-[1,2,4]TRIAZOLIDIN-3-ONE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-BENZYL-5-THIOXO-[1,2,4]TRIAZOLIDIN-3-ONE |
|---|
| CAS Number | 119482-69-8 | Molecular Weight | 207.25200 |
|---|
| Density | 1.42g/cm3 | Boiling Point | 457.8ºC at 760mmHg |
|---|
| Molecular Formula | C9H9N3OS | Melting Point | / |
|---|
| MSDS | / | Flash Point | 230.7ºC |
|---|
Names
| Name | 4-benzyl-5-sulfanylidene-1,2,4-triazolidin-3-one |
|---|
Chemical & Physical Properties
| Density | 1.42g/cm3 |
|---|
| Boiling Point | 457.8ºC at 760mmHg |
|---|
| Molecular Formula | C9H9N3OS |
|---|
| Molecular Weight | 207.25200 |
|---|
| Flash Point | 230.7ºC |
|---|
| Exact Mass | 207.04700 |
|---|
| PSA | 89.74000 |
|---|
| LogP | 1.32070 |
|---|
| Vapour Pressure | 5.3E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.714 |
|---|
| InChIKey | NVHZYKDMJINPIN-UHFFFAOYSA-N |
|---|
| SMILES | O=c1[nH][nH]c(=S)n1Cc1ccccc1 |
|---|