Introduction：Basic information about CAS 1502-47-2|Melem, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Melem |
|---|
| CAS Number | 1502-47-2 | Molecular Weight | 218.17900 |
|---|
| Density | 2.98g/cm3 | Boiling Point | 440.3ºC at 760mmHg |
|---|
| Molecular Formula | C6H6N10 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 220.1ºC |
|---|
Names
| Name | melem |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.98g/cm3 |
|---|
| Boiling Point | 440.3ºC at 760mmHg |
|---|
| Molecular Formula | C6H6N10 |
|---|
| Molecular Weight | 218.17900 |
|---|
| Flash Point | 220.1ºC |
|---|
| Exact Mass | 218.07800 |
|---|
| PSA | 162.00000 |
|---|
| Vapour Pressure | 5.95E-08mmHg at 25°C |
|---|
| Index of Refraction | 2.78 |
|---|
| InChIKey | YSRVJVDFHZYRPA-UHFFFAOYSA-N |
|---|
| SMILES | N=c1nc2n3c(nc(N)nc3n1)NC(N)=N2 |
|---|
Synonyms
| 2,5,8-Triamino-1,3,4,6,7,9,9b-heptaaza-phenalene |
| 2,5,8-triamino-s-heptazine |
| Melem |
| 2,5,8-triamino-tri-s-triazine |
| 1,3,4,6,7,9,9b-Heptaazaphenalene-2,5,8-triamine |
| Triamino-s-heptazine |
| EINECS 216-122-4 |
| Cyamelurotriamide |
