Introduction：Basic information about CAS 4272-77-9|5-(Dimethylamino)-1-naphthalenesulfonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(Dimethylamino)-1-naphthalenesulfonic acid |
|---|
| CAS Number | 4272-77-9 | Molecular Weight | 251.30200 |
|---|
| Density | 1.363 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C12H13NO3S | Melting Point | 316ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 5-(dimethylamino)naphthalene-1-sulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.363 g/cm3 |
|---|
| Melting Point | 316ºC |
|---|
| Molecular Formula | C12H13NO3S |
|---|
| Molecular Weight | 251.30200 |
|---|
| Exact Mass | 251.06200 |
|---|
| PSA | 65.99000 |
|---|
| LogP | 3.23330 |
|---|
| InChIKey | BBEQQKBWUHCIOU-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)c1cccc2c(S(=O)(=O)O)cccc12 |
|---|
| Storage condition | Refrigerator |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2921199090 |
|---|
Customs
| HS Code | 2921199090 |
|---|
| Summary | 2921199090 other acyclic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 5-Dimethylaminonaphthalene-1-sulfonic Acid |
| EINECS 224-268-5 |
| Dansyl acid |
| 5-(Dimethylamino)-1-naphthalenesulfonic acid |
