Introduction：Basic information about CAS 4010-33-7|2-Acetylphenyl benzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Acetylphenyl benzoate |
|---|
| CAS Number | 4010-33-7 | Molecular Weight | 240.254 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 420.0±28.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H12O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 188.6±24.0 °C |
|---|
Names
| Name | (2-acetylphenyl) benzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 420.0±28.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H12O3 |
|---|
| Molecular Weight | 240.254 |
|---|
| Flash Point | 188.6±24.0 °C |
|---|
| Exact Mass | 240.078644 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 2.85 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.579 |
|---|
| InChIKey | UEVPPUDQJRWOLT-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)c1ccccc1OC(=O)c1ccccc1 |
|---|
Synonyms
| 2-Acetylphenyl benzoate |
| Acetophenone, 2-hydroxy-, benzoate |
| o-(Benzoyloxy)acetophenone |
| o-Benzoyloxyacetophenone |
| O-Acetylphenyl Benzoate |
| o-benzoyoxyacetophenone |
| Ethanone, 1-[2- (benzoyloxy)phenyl]- |
| MFCD00017235 |
| Ethanone, 1-(2-(benzoyloxy)phenyl)- |
| Ethanone, 1-[2-(benzoyloxy)phenyl]- |
