Introduction：Basic information about CAS 5958-24-7|Cmpcqo, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cmpcqo |
|---|
| CAS Number | 5958-24-7 | Molecular Weight | 305.15900 |
|---|
| Density | 1.38g/cm3 | Boiling Point | 495.6ºC at 760 mmHg |
|---|
| Molecular Formula | C15H10Cl2N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 253.5ºC |
|---|
Names
| Name | 6-chloro-2-(chloromethyl)-3-oxido-4-phenylquinazolin-3-ium |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.38g/cm3 |
|---|
| Boiling Point | 495.6ºC at 760 mmHg |
|---|
| Molecular Formula | C15H10Cl2N2O |
|---|
| Molecular Weight | 305.15900 |
|---|
| Flash Point | 253.5ºC |
|---|
| Exact Mass | 304.01700 |
|---|
| PSA | 38.35000 |
|---|
| LogP | 4.72250 |
|---|
| Index of Refraction | 1.658 |
|---|
| InChIKey | KFDNKXWSTFABQT-UHFFFAOYSA-N |
|---|
| SMILES | [O-][n+]1c(CCl)nc2ccc(Cl)cc2c1-c1ccccc1 |
|---|
Synonyms
| Cmpcqo |
| 6-chloro-2-chloromethyl-4-phenylquinazoline-3-oxide |
| 2-Chlormethyl-6-chlor-4-phenylchinazolin-3-oxid |
| 2-Chlormethyl-4-phenyl-6-chlorchinazolin-3-oxid |
| 2-Chloromethyl-4-phenyl-6-chloroquinazoline-3-oxide |
