Introduction：Basic information about CAS 67801-43-8|para-cresyl 3-oxo-3-phenyl propionate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | para-cresyl 3-oxo-3-phenyl propionate |
|---|
| CAS Number | 67801-43-8 | Molecular Weight | 254.28100 |
|---|
| Density | 1.159g/cm3 | Boiling Point | 409.5ºC at 760 mmHg |
|---|
| Molecular Formula | C16H14O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 182.2ºC |
|---|
Names
| Name | (4-methylphenyl) 3-oxo-3-phenylpropanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.159g/cm3 |
|---|
| Boiling Point | 409.5ºC at 760 mmHg |
|---|
| Molecular Formula | C16H14O3 |
|---|
| Molecular Weight | 254.28100 |
|---|
| Flash Point | 182.2ºC |
|---|
| Exact Mass | 254.09400 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 3.17340 |
|---|
| Index of Refraction | 1.57 |
|---|
| InChIKey | MWPINOUUZCUQDV-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(OC(=O)CC(=O)c2ccccc2)cc1 |
|---|
Synonyms
| EINECS 267-164-5 |
| 4-methylphenyl benzoylacetate |
| p-Tolyl 3-oxo-3-phenylpropionate |
