Introduction：Basic information about CAS 67828-22-2|2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(azo)]bis[N-(2,4-dim, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(azo)]bis[N-(2,4-dimethoxyphenyl)-3-oxobutyramide] |
|---|
| CAS Number | 67828-22-2 | Molecular Weight | 749.59700 |
|---|
| Density | 1.35g/cm3 | Boiling Point | 854.3ºC at 760 mmHg |
|---|
| Molecular Formula | C36H34Cl2N6O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 470.5ºC |
|---|
Names
| Name | 2-[[2-chloro-4-[3-chloro-4-[[1-(2,4-dimethoxyanilino)-1,3-dioxobutan-2-yl]diazenyl]phenyl]phenyl]diazenyl]-N-(2,4-dimethoxyphenyl)-3-oxobutanamide |
|---|
Chemical & Physical Properties
| Density | 1.35g/cm3 |
|---|
| Boiling Point | 854.3ºC at 760 mmHg |
|---|
| Molecular Formula | C36H34Cl2N6O8 |
|---|
| Molecular Weight | 749.59700 |
|---|
| Flash Point | 470.5ºC |
|---|
| Exact Mass | 748.18200 |
|---|
| PSA | 185.68000 |
|---|
| LogP | 9.35380 |
|---|
| Index of Refraction | 1.617 |
|---|
| InChIKey | WFCJLCVNQRYFRP-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(NC(=O)C(N=Nc2ccc(-c3ccc(N=NC(C(C)=O)C(=O)Nc4ccc(OC)cc4OC)c(Cl)c3)cc2Cl)C(C)=O)c(OC)c1 |
|---|
