Introduction：Basic information about CAS 84937-88-2|tetramethylfluthrin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tetramethylfluthrin |
|---|
| CAS Number | 84937-88-2 | Molecular Weight | 348.33300 |
|---|
| Density | 1.225g/cm3 | Boiling Point | 313.511ºC at 760 mmHg |
|---|
| Molecular Formula | C17H20F4O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 138.788ºC |
|---|
Names
| Name | tetramethylfluthrin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.225g/cm3 |
|---|
| Boiling Point | 313.511ºC at 760 mmHg |
|---|
| Molecular Formula | C17H20F4O3 |
|---|
| Molecular Weight | 348.33300 |
|---|
| Flash Point | 138.788ºC |
|---|
| Exact Mass | 348.13500 |
|---|
| PSA | 35.53000 |
|---|
| LogP | 4.11480 |
|---|
| Index of Refraction | 1.469 |
|---|
| InChIKey | APEPLROGLDYWBS-UHFFFAOYSA-N |
|---|
| SMILES | COCc1c(F)c(F)c(COC(=O)C2C(C)(C)C2(C)C)c(F)c1F |
|---|
Synonyms
| Tetramethylfluthrin |
| [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl 2,2,3,3-tetramethylcyclopropane-1-carboxylate |
| [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl 2,2,3,3-tetramethylcyclopropanecarboxylate |
| 2,3,5,6-tetrafluoro-4-(methoxymethyl)benzyl 2,2,3,3-tetramethylcyclopropanecarboxylate |
| sifumijvzhi |
