Introduction：Basic information about CAS 85423-11-6|2,6-bis[2-isocyanato-3-[(2-isocyanatophenyl)methyl]benzyl]phenyl isocyanate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,6-bis[2-isocyanato-3-[(2-isocyanatophenyl)methyl]benzyl]phenyl isocyanate |
|---|
| CAS Number | 85423-11-6 | Molecular Weight | 643.64600 |
|---|
| Density | 1.22g/cm3 | Boiling Point | 782.7ºC at 760 mmHg |
|---|
| Molecular Formula | C39H25N5O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 306.4ºC |
|---|
Names
| Name | 2-isocyanato-1,3-bis[[2-isocyanato-3-[(2-isocyanatophenyl)methyl]phenyl]methyl]benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.22g/cm3 |
|---|
| Boiling Point | 782.7ºC at 760 mmHg |
|---|
| Molecular Formula | C39H25N5O5 |
|---|
| Molecular Weight | 643.64600 |
|---|
| Flash Point | 306.4ºC |
|---|
| Exact Mass | 643.18600 |
|---|
| PSA | 147.15000 |
|---|
| LogP | 7.88630 |
|---|
| Index of Refraction | 1.637 |
|---|
| InChIKey | AHXPEHBCIOCGOK-UHFFFAOYSA-N |
|---|
| SMILES | O=C=Nc1ccccc1Cc1cccc(Cc2cccc(Cc3cccc(Cc4ccccc4N=C=O)c3N=C=O)c2N=C=O)c1N=C=O |
|---|
Synonyms
| EINECS 287-215-5 |
| 2,6-Bis(2-isocyanato-3-((2-isocyanatophenyl)methyl)benzyl)phenyl isocyanate |
| Benzene,2-isocyanato-1,3-bis((2-isocyanato-3-((2-isocyanatophenyl)methyl)phenyl)methyl) |
