Introduction：Basic information about CAS 59798-73-1|enilospirone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | enilospirone |
|---|
| CAS Number | 59798-73-1 | Molecular Weight | 295.76100 |
|---|
| Density | 1.286g/cm3 | Boiling Point | 497.89ºC at 760 mmHg |
|---|
| Molecular Formula | C15H18ClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 254.915ºC |
|---|
Names
| Name | 6-(3-chlorophenoxy)-2-methyl-1-oxa-4-azaspiro[4.5]decan-3-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.286g/cm3 |
|---|
| Boiling Point | 497.89ºC at 760 mmHg |
|---|
| Molecular Formula | C15H18ClNO3 |
|---|
| Molecular Weight | 295.76100 |
|---|
| Flash Point | 254.915ºC |
|---|
| Exact Mass | 295.09800 |
|---|
| PSA | 47.56000 |
|---|
| LogP | 3.22140 |
|---|
| Index of Refraction | 1.579 |
|---|
| InChIKey | PSHBCUHYCLAGPZ-BAOLWLNASA-N |
|---|
| SMILES | CC1OC2(CCCCC2Oc2cccc(Cl)c2)NC1=O |
|---|
Synonyms
| Enilospirona [Spanish] |
| Enilospironum |
| Enilospirona |
| 3726CERM |
| Enilospironum [Latin] |
| enilospirone |
| 6-(3-chloro)phenoxy-3-methyl-2-oxo-1-aza-4-oxa-spiro [ 4.5 ] decane |
| 6-(3-chloro-phenoxy)-2-methyl-1-oxa-4-aza-spiro[4.5]decan-3-one |
