Introduction：Basic information about CAS 158567-91-0|(2R,4R)-1-(tert-Butoxycarbonyl)-4-phenylpyrrolidine-2-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2R,4R)-1-(tert-Butoxycarbonyl)-4-phenylpyrrolidine-2-carboxylic acid |
|---|
| CAS Number | 158567-91-0 | Molecular Weight | 291.34200 |
|---|
| Density | 1.196g/cm3 | Boiling Point | 441.5ºC at 760 mmHg |
|---|
| Molecular Formula | C16H21NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 220.8ºC |
|---|
Names
| Name | (2R,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenylpyrrolidine-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.196g/cm3 |
|---|
| Boiling Point | 441.5ºC at 760 mmHg |
|---|
| Molecular Formula | C16H21NO4 |
|---|
| Molecular Weight | 291.34200 |
|---|
| Flash Point | 220.8ºC |
|---|
| Exact Mass | 291.14700 |
|---|
| PSA | 66.84000 |
|---|
| LogP | 2.80210 |
|---|
| Vapour Pressure | 1.43E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.548 |
|---|
| InChIKey | JDAQDIQHICLYKH-QWHCGFSZSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CC(c2ccccc2)CC1C(=O)O |
|---|
Synonyms
| B-1651 |
| (2R,4R)-1-(tert-butoxycarbonyl)-4-phenylpyrrolidine-2-carboxylic acid |
